Coupling Agent TM-550 1. Foreign Trade Name A-1100(The United Carbide Company of America) 2. Chemical Name: --Aminopropyl triethoxy silane 3. Structual Formula:NH2-CH2-CH2-CH2-Si(OC2H5)3 4. Specification: Appearance: Colorless or brownish yellow transparent liquid Density(d425) 0.939-0.948 Flashing Point(nD25) 1.4175-1.4205 Boiling Point 217 /760mm Pg Content (vapor phase chromatography) 95% 5. Application: Contains two different active genes,amino and oxethy, suitable for crosslinking organic polymer and inorganic filling material, helps improving its adhesive strength, enhances the product's mechanical, electrical,water fastness, anti-aging ability. Mainly used in glass fiber, casting, textile assistants, insulating material and adhesive industry. Suitable as the crosslinking agent in polymers like: epoxy, phenolic,trimeric cyanamide, nylon, polyethene, polyacrylic acid, polyurethane, polysulfide rubber, acrylonitrile-butadiene rubber,etc..